C11H11Cl2N3O4 — CID 78906552
3,4-dichloro-N-morpholin-4-yl-5-nitrobenzamide (PubChem CID 78906552) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3,4-dichloro-N-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 78906552 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 3,4-dichloro-N-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(NN1CCOCC1)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11Cl2N3O4/c12-8-5-7(6-9(10(8)13)16(18)19)11(17)14-15-1-3-20-4-2-15/h5-6H,1-4H2,(H,14,17) |
| InChIKey | DDPWIBFLPVXQHD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|