C11H13N5O6 — CID 132593751
4-morpholin-4-yl-3,5-dinitrobenzohydrazide (PubChem CID 132593751) has the molecular formula C11H13N5O6 and a molecular weight of 311.25 g/mol. Its IUPAC name is 4-morpholin-4-yl-3,5-dinitrobenzohydrazide.
| Compound Name | 4-morpholin-4-yl-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 132593751 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-morpholin-4-yl-3,5-dinitrobenzohydrazide |
| SMILES | NNC(=O)c1cc([N+](=O)[O-])c(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N5O6/c12-13-11(17)7-5-8(15(18)19)10(9(6-7)16(20)21)14-1-3-22-4-2-14/h5-6H,1-4,12H2,(H,13,17) |
| InChIKey | ZHFMKOLXPXINAZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|