C23H20ClN5O8S — CID 25042551
N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-morpholin-4-yl-3,5-dinitrobenzamide (PubChem CID 25042551) has the molecular formula C23H20ClN5O8S and a molecular weight of 561.96 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-morpholin-4-yl-3,5-dinitrobenzamide.
| Compound Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-morpholin-4-yl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 25042551 |
| Molecular Formula | C23H20ClN5O8S |
| Molecular Weight | 561.96 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-morpholin-4-yl-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1)c1cc([N+](=O)[O-])c(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClN5O8S/c24-18-3-1-2-4-19(18)26-38(35,36)17-7-5-16(6-8-17)25-23(30)15-13-20(28(31)32)22(21(14-15)29(33)34)27-9-11-37-12-10-27/h1-8,13-14,26H,9-12H2,(H,25,30) |
| InChIKey | YXISOKJPJAFJNG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.96 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|