C29H26Cl2N4O6S2 — CID 4206577
N-[3-[(2-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 4206577) has the molecular formula C29H26Cl2N4O6S2 and a molecular weight of 661.59 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 4206577 |
| Molecular Formula | C29H26Cl2N4O6S2 |
| Molecular Weight | 661.59 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(S(=O)(=O)Nc2ccccc2Cl)c1)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H26Cl2N4O6S2/c30-20-9-12-22(13-10-20)42(37,38)33-25-7-3-1-5-23(25)29(36)32-21-11-14-27(35-15-17-41-18-16-35)28(19-21)43(39,40)34-26-8-4-2-6-24(26)31/h1-14,19,33-34H,15-18H2,(H,32,36) |
| InChIKey | WBVQKIGIOGVRQC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|