C23H26Cl2N4O4S2 — CID 4162559
N-[[3-[(2,5-dichlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]carbamothioyl]cyclopentanecarboxamide (PubChem CID 4162559) has the molecular formula C23H26Cl2N4O4S2 and a molecular weight of 557.53 g/mol. Its IUPAC name is N-[[3-[(2,5-dichlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]carbamothioyl]cyclopentanecarboxamide.
| Compound Name | N-[[3-[(2,5-dichlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]carbamothioyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 4162559 |
| Molecular Formula | C23H26Cl2N4O4S2 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | N-[[3-[(2,5-dichlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]carbamothioyl]cyclopentanecarboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCOCC2)c(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C23H26Cl2N4O4S2/c24-16-5-7-18(25)19(13-16)28-35(31,32)21-14-17(6-8-20(21)29-9-11-33-12-10-29)26-23(34)27-22(30)15-3-1-2-4-15/h5-8,13-15,28H,1-4,9-12H2,(H2,26,27,30,34) |
| InChIKey | SOQXRQFJTDPPNM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|