C16H17Cl2N3O3S — CID 3870175
5-amino-N-(2,5-dichlorophenyl)-2-morpholin-4-ylbenzenesulfonamide (PubChem CID 3870175) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is 5-amino-N-(2,5-dichlorophenyl)-2-morpholin-4-ylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2,5-dichlorophenyl)-2-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3870175 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-amino-N-(2,5-dichlorophenyl)-2-morpholin-4-ylbenzenesulfonamide |
| SMILES | Nc1ccc(N2CCOCC2)c(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N3O3S/c17-11-1-3-13(18)14(9-11)20-25(22,23)16-10-12(19)2-4-15(16)21-5-7-24-8-6-21/h1-4,9-10,20H,5-8,19H2 |
| InChIKey | DTKQHSUVSPYGCK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|