About 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid
3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 4806611) has the molecular formula C19H21ClN2O5S
and a molecular weight of 424.91 g/mol. Its IUPAC name is 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| PubChem CID | 4806611 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cc(Cl)ccc2N2CCOCC2)c1C |
| InChI | InChI=1S/C19H21ClN2O5S/c1-12-9-14(19(23)24)10-18(13(12)2)28(25,26)21-16-11-15(20)3-4-17(16)22-5-7-27-8-6-22/h3-4,9-11,21H,5-8H2,1-2H3,(H,23,24) |
| InChIKey | RCVSFUKBQBPCAF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid?
The IUPAC name of 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid (CID 4806611) is 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid.
What is the SMILES notation for 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid?
The canonical SMILES for 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid is Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cc(Cl)ccc2N2CCOCC2)c1C.
What is the InChIKey of 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid?
The InChIKey is RCVSFUKBQBPCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O5S/c1-12-9-14(19(23)24)10-18(13(12)2)28(25,26)21-16-11-15(20)3-4-17(16)22-5-7-27-8-6-22/h3-4,9-11,21H,5-8H2,1-2H3,(H,23,24).
What are the key properties of 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid?
3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid has a molecular weight of 424.91 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid is sourced from PubChem (CID 4806611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).