C19H21ClN2O5S — CID 4806611
3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 4806611) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 4806611 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cc(Cl)ccc2N2CCOCC2)c1C |
| InChI | InChI=1S/C19H21ClN2O5S/c1-12-9-14(19(23)24)10-18(13(12)2)28(25,26)21-16-11-15(20)3-4-17(16)22-5-7-27-8-6-22/h3-4,9-11,21H,5-8H2,1-2H3,(H,23,24) |
| InChIKey | RCVSFUKBQBPCAF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |