C12H15N5O5 — CID 132593891
4-(cyclopentylamino)-3,5-dinitrobenzohydrazide (PubChem CID 132593891) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 4-(cyclopentylamino)-3,5-dinitrobenzohydrazide.
| Compound Name | 4-(cyclopentylamino)-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 132593891 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-(cyclopentylamino)-3,5-dinitrobenzohydrazide |
| SMILES | NNC(=O)c1cc([N+](=O)[O-])c(NC2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N5O5/c13-15-12(18)7-5-9(16(19)20)11(10(6-7)17(21)22)14-8-3-1-2-4-8/h5-6,8,14H,1-4,13H2,(H,15,18) |
| InChIKey | APRRVRDQKFTBBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|