C8H8N4O6 — CID 4298975
4-methoxy-3,5-dinitrobenzohydrazide (PubChem CID 4298975) has the molecular formula C8H8N4O6 and a molecular weight of 256.17 g/mol. Its IUPAC name is 4-methoxy-3,5-dinitrobenzohydrazide.
| Compound Name | 4-methoxy-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 4298975 |
| Molecular Formula | C8H8N4O6 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-methoxy-3,5-dinitrobenzohydrazide |
| SMILES | COc1c([N+](=O)[O-])cc(C(=O)NN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N4O6/c1-18-7-5(11(14)15)2-4(8(13)10-9)3-6(7)12(16)17/h2-3H,9H2,1H3,(H,10,13) |
| InChIKey | JSCOYUNWXGICBZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|