C11H10NO7- — CID 21459038
3-(3,4-dimethoxy-5-nitrophenyl)-3-oxopropanoate (PubChem CID 21459038) has the molecular formula C11H10NO7- and a molecular weight of 268.20 g/mol. Its IUPAC name is 3-(3,4-dimethoxy-5-nitrophenyl)-3-oxopropanoate.
| Compound Name | 3-(3,4-dimethoxy-5-nitrophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 21459038 |
| Molecular Formula | C11H10NO7- |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-(3,4-dimethoxy-5-nitrophenyl)-3-oxopropanoate |
| SMILES | COc1cc(C(=O)CC(=O)[O-])cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C11H11NO7/c1-18-9-4-6(8(13)5-10(14)15)3-7(12(16)17)11(9)19-2/h3-4H,5H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | RLTHVBNZNGNPOH-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 118.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|