C12H11NO9 — CID 21459187
2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid (PubChem CID 21459187) has the molecular formula C12H11NO9 and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid.
| Compound Name | 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid |
|---|---|
| PubChem CID | 21459187 |
| Molecular Formula | C12H11NO9 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid |
| SMILES | COc1cc(C(=O)C(C(=O)O)C(=O)O)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C12H11NO9/c1-21-7-4-5(3-6(13(19)20)10(7)22-2)9(14)8(11(15)16)12(17)18/h3-4,8H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BDIOLLAHJSYMBV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|