2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid

C12H11NO9 — CID 21459187

IUPAC2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid
SMILESCOc1cc(C(=O)C(C(=O)O)C(=O)O)cc([N+](=O)[O-])c1OC
InChIInChI=1S/C12H11NO9/c1-21-7-4-5(3-6(13(19)20)10(7)22-2)9(14)8(11(15)16)12(17)18/h3-4,8H,1-2H3,(H,15,16)(H,17,18)
InChIKeyBDIOLLAHJSYMBV-UHFFFAOYSA-N
MW313.22 g/mol
LogP0.58
Rot. Bonds7

About 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid

2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid (PubChem CID 21459187) has the molecular formula C12H11NO9 and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid.

Molecular Properties

Compound Name2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid
PubChem CID21459187
Molecular FormulaC12H11NO9
Molecular Weight313.22 g/mol
Exact Mass313.04
IUPAC Name2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid
SMILESCOc1cc(C(=O)C(C(=O)O)C(=O)O)cc([N+](=O)[O-])c1OC
InChIInChI=1S/C12H11NO9/c1-21-7-4-5(3-6(13(19)20)10(7)22-2)9(14)8(11(15)16)12(17)18/h3-4,8H,1-2H3,(H,15,16)(H,17,18)
InChIKeyBDIOLLAHJSYMBV-UHFFFAOYSA-N
XLogP0.58
TPSA153.27 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.22
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid?
The IUPAC name of 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid (CID 21459187) is 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid.
What is the SMILES notation for 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid?
The canonical SMILES for 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid is COc1cc(C(=O)C(C(=O)O)C(=O)O)cc([N+](=O)[O-])c1OC.
What is the InChIKey of 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid?
The InChIKey is BDIOLLAHJSYMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO9/c1-21-7-4-5(3-6(13(19)20)10(7)22-2)9(14)8(11(15)16)12(17)18/h3-4,8H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid?
2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid has a molecular weight of 313.22 g/mol, XLogP of 0.58, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxy-5-nitrobenzoyl)propanedioic acid is sourced from PubChem (CID 21459187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).