C16H14FNO6 — CID 172740515
(3,4-dimethoxy-5-nitrophenyl)-(3-fluoro-5-methoxyphenyl)methanone (PubChem CID 172740515) has the molecular formula C16H14FNO6 and a molecular weight of 335.29 g/mol. Its IUPAC name is (3,4-dimethoxy-5-nitrophenyl)-(3-fluoro-5-methoxyphenyl)methanone.
| Compound Name | (3,4-dimethoxy-5-nitrophenyl)-(3-fluoro-5-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 172740515 |
| Molecular Formula | C16H14FNO6 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (3,4-dimethoxy-5-nitrophenyl)-(3-fluoro-5-methoxyphenyl)methanone |
| SMILES | COc1cc(F)cc(C(=O)c2cc(OC)c(OC)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H14FNO6/c1-22-12-5-9(4-11(17)8-12)15(19)10-6-13(18(20)21)16(24-3)14(7-10)23-2/h4-8H,1-3H3 |
| InChIKey | JAMWMABPNBVIDV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|