C29H22F2N2O10 — CID 158356325
(3,4-dimethoxy-5-nitrophenyl)-(2-fluorophenyl)methanone;(2-fluorophenyl)-(4-hydroxy-3-methoxy-5-nitrophenyl)methanone (PubChem CID 158356325) has the molecular formula C29H22F2N2O10 and a molecular weight of 596.50 g/mol. Its IUPAC name is (3,4-dimethoxy-5-nitrophenyl)-(2-fluorophenyl)methanone;(2-fluorophenyl)-(4-hydroxy-3-methoxy-5-nitrophenyl)methanone.
| Compound Name | (3,4-dimethoxy-5-nitrophenyl)-(2-fluorophenyl)methanone;(2-fluorophenyl)-(4-hydroxy-3-methoxy-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 158356325 |
| Molecular Formula | C29H22F2N2O10 |
| Molecular Weight | 596.50 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | (3,4-dimethoxy-5-nitrophenyl)-(2-fluorophenyl)methanone;(2-fluorophenyl)-(4-hydroxy-3-methoxy-5-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccccc2F)cc([N+](=O)[O-])c1O.COc1cc(C(=O)c2ccccc2F)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C15H12FNO5.C14H10FNO5/c1-21-13-8-9(7-12(17(19)20)15(13)22-2)14(18)10-5-3-4-6-11(10)16;1-21-12-7-8(6-11(14(12)18)16(19)20)13(17)9-4-2-3-5-10(9)15/h3-8H,1-2H3;2-7,18H,1H3 |
| InChIKey | GSXQMQZXJJAUIE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|