C30H28N2O8 — CID 159399191
(3-amino-4,5-dimethoxyphenyl)-phenylmethanone;(3,4-dimethoxy-5-nitrophenyl)-phenylmethanone (PubChem CID 159399191) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is (3-amino-4,5-dimethoxyphenyl)-phenylmethanone;(3,4-dimethoxy-5-nitrophenyl)-phenylmethanone.
| Compound Name | (3-amino-4,5-dimethoxyphenyl)-phenylmethanone;(3,4-dimethoxy-5-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 159399191 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (3-amino-4,5-dimethoxyphenyl)-phenylmethanone;(3,4-dimethoxy-5-nitrophenyl)-phenylmethanone |
| SMILES | COc1cc(C(=O)c2ccccc2)cc(N)c1OC.COc1cc(C(=O)c2ccccc2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C15H13NO5.C15H15NO3/c1-20-13-9-11(8-12(16(18)19)15(13)21-2)14(17)10-6-4-3-5-7-10;1-18-13-9-11(8-12(16)15(13)19-2)14(17)10-6-4-3-5-7-10/h3-9H,1-2H3;3-9H,16H2,1-2H3 |
| InChIKey | LNCVLXUCGBBXSE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|