C14H10N2O5 — CID 15084102
(4-methyl-3,5-dinitrophenyl)-phenylmethanone (PubChem CID 15084102) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is (4-methyl-3,5-dinitrophenyl)-phenylmethanone.
| Compound Name | (4-methyl-3,5-dinitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 15084102 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (4-methyl-3,5-dinitrophenyl)-phenylmethanone |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N2O5/c1-9-12(15(18)19)7-11(8-13(9)16(20)21)14(17)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | AZJAYNNBSXWEEB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|