C15H12FNO5 — CID 142658241
(3,4-dimethoxyphenyl)-(4-fluoro-3-nitrophenyl)methanone (PubChem CID 142658241) has the molecular formula C15H12FNO5 and a molecular weight of 305.26 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(4-fluoro-3-nitrophenyl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(4-fluoro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 142658241 |
| Molecular Formula | C15H12FNO5 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(4-fluoro-3-nitrophenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(F)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C15H12FNO5/c1-21-13-6-4-10(8-14(13)22-2)15(18)9-3-5-11(16)12(7-9)17(19)20/h3-8H,1-2H3 |
| InChIKey | PWHGZRJTDYKYLC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|