C14H9F2NO5 — CID 8751807
(3,4-difluorophenyl) 4-methoxy-3-nitrobenzoate (PubChem CID 8751807) has the molecular formula C14H9F2NO5 and a molecular weight of 309.22 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-methoxy-3-nitrobenzoate.
| Compound Name | (3,4-difluorophenyl) 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 8751807 |
| Molecular Formula | C14H9F2NO5 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | (3,4-difluorophenyl) 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(F)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F2NO5/c1-21-13-5-2-8(6-12(13)17(19)20)14(18)22-9-3-4-10(15)11(16)7-9/h2-7H,1H3 |
| InChIKey | AUKBCBZCFWJRMW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|