C17H17NO7 — CID 11100097
(4-methoxy-2-nitrophenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 11100097) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-methoxy-2-nitrophenyl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11100097 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (4-methoxy-2-nitrophenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(OC)c(OC)c(OC)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17NO7/c1-22-11-5-6-12(13(9-11)18(20)21)16(19)10-7-14(23-2)17(25-4)15(8-10)24-3/h5-9H,1-4H3 |
| InChIKey | SVUJFDLGYLMLNO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|