C17H18O5 — CID 10902719
(3-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 10902719) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (3-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 10902719 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H18O5/c1-19-13-7-5-6-11(8-13)16(18)12-9-14(20-2)17(22-4)15(10-12)21-3/h5-10H,1-4H3 |
| InChIKey | KZFNHXYYISYETO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |