C18H20O5 — CID 174357857
[3-(1-hydroxyethyl)phenyl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 174357857) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is [3-(1-hydroxyethyl)phenyl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-(1-hydroxyethyl)phenyl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 174357857 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [3-(1-hydroxyethyl)phenyl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cccc(C(C)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H20O5/c1-11(19)12-6-5-7-13(8-12)17(20)14-9-15(21-2)18(23-4)16(10-14)22-3/h5-11,19H,1-4H3 |
| InChIKey | DXZPZKNMRJVHLV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |