C11H16O4 — CID 63365303
(1R)-1-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 63365303) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1R)-1-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | (1R)-1-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 63365303 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1R)-1-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc([C@@H](C)O)cc(OC)c1OC |
| InChI | InChI=1S/C11H16O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-7,12H,1-4H3/t7-/m1/s1 |
| InChIKey | IONRJSKJWDOGAY-SSDOTTSWSA-N |
| XLogP | 1.77 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |