C9H10F2O2 — CID 97293354
(1S)-1-(3,4-difluoro-5-methoxyphenyl)ethanol (PubChem CID 97293354) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is (1S)-1-(3,4-difluoro-5-methoxyphenyl)ethanol.
| Compound Name | (1S)-1-(3,4-difluoro-5-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 97293354 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (1S)-1-(3,4-difluoro-5-methoxyphenyl)ethanol |
| SMILES | COc1cc([C@H](C)O)cc(F)c1F |
| InChI | InChI=1S/C9H10F2O2/c1-5(12)6-3-7(10)9(11)8(4-6)13-2/h3-5,12H,1-2H3/t5-/m0/s1 |
| InChIKey | UWLUXYSJFGYCQU-YFKPBYRVSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |