C10H13F2NO — CID 130783775
(1S)-1-(3,4-difluoro-5-methoxyphenyl)-N-methylethanamine (PubChem CID 130783775) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is (1S)-1-(3,4-difluoro-5-methoxyphenyl)-N-methylethanamine.
| Compound Name | (1S)-1-(3,4-difluoro-5-methoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 130783775 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (1S)-1-(3,4-difluoro-5-methoxyphenyl)-N-methylethanamine |
| SMILES | CN[C@@H](C)c1cc(F)c(F)c(OC)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-6(13-2)7-4-8(11)10(12)9(5-7)14-3/h4-6,13H,1-3H3/t6-/m0/s1 |
| InChIKey | LAUZICCNHWUZKR-LURJTMIESA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |