C10H15FN2O — CID 116954300
1-(3-fluoro-4-methoxyphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954300) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954300 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C10H15FN2O/c1-12-10(13-2)7-4-5-9(14-3)8(11)6-7/h4-6,10,12-13H,1-3H3 |
| InChIKey | VMFXRBQZJWHXOV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|