C11H16FNOS — CID 116831365
3-(3-fluoro-4-methoxyphenyl)-3-(methylamino)propane-1-thiol (PubChem CID 116831365) has the molecular formula C11H16FNOS and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-3-(methylamino)propane-1-thiol.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-3-(methylamino)propane-1-thiol |
|---|---|
| PubChem CID | 116831365 |
| Molecular Formula | C11H16FNOS |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-3-(methylamino)propane-1-thiol |
| SMILES | CNC(CCS)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C11H16FNOS/c1-13-10(5-6-15)8-3-4-11(14-2)9(12)7-8/h3-4,7,10,13,15H,5-6H2,1-2H3 |
| InChIKey | DPZSHUZFUDPLHA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|