C12H14F2O4S — CID 170822281
S-[3-(3,4-difluoro-5-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822281) has the molecular formula C12H14F2O4S and a molecular weight of 292.30 g/mol. Its IUPAC name is S-[3-(3,4-difluoro-5-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3,4-difluoro-5-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822281 |
| Molecular Formula | C12H14F2O4S |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | S-[3-(3,4-difluoro-5-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | COc1cc(C(O)C(O)CSC(C)=O)cc(F)c1F |
| InChI | InChI=1S/C12H14F2O4S/c1-6(15)19-5-9(16)12(17)7-3-8(13)11(14)10(4-7)18-2/h3-4,9,12,16-17H,5H2,1-2H3 |
| InChIKey | OTYJYOOSNJFJFT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|