C13H16O5S — CID 170822217
S-[3-(3-formyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822217) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is S-[3-(3-formyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3-formyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822217 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | S-[3-(3-formyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | COc1ccc(C(O)C(O)CSC(C)=O)cc1C=O |
| InChI | InChI=1S/C13H16O5S/c1-8(15)19-7-11(16)13(17)9-3-4-12(18-2)10(5-9)6-14/h3-6,11,13,16-17H,7H2,1-2H3 |
| InChIKey | URZMAOUACVGWLA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|