C16H20N2O4S — CID 170823130
S-[2,3-dihydroxy-3-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]propyl] ethanethioate (PubChem CID 170823130) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 170823130 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | S-[2,3-dihydroxy-3-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]propyl] ethanethioate |
| SMILES | COc1ccc(C(O)C(O)CSC(C)=O)cc1Cn1cccn1 |
| InChI | InChI=1S/C16H20N2O4S/c1-11(19)23-10-14(20)16(21)12-4-5-15(22-2)13(8-12)9-18-7-3-6-17-18/h3-8,14,16,20-21H,9-10H2,1-2H3 |
| InChIKey | KNUITTQHDZUVPZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|