C11H13N3O3S — CID 170822119
S-[3-(2H-benzotriazol-5-yl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822119) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is S-[3-(2H-benzotriazol-5-yl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2H-benzotriazol-5-yl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822119 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | S-[3-(2H-benzotriazol-5-yl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C11H13N3O3S/c1-6(15)18-5-10(16)11(17)7-2-3-8-9(4-7)13-14-12-8/h2-4,10-11,16-17H,5H2,1H3,(H,12,13,14) |
| InChIKey | CUWQZJFUGDBYGS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|