C12H17NO3S — CID 170821657
S-[3-(4-amino-3-methylphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821657) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is S-[3-(4-amino-3-methylphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(4-amino-3-methylphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821657 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | S-[3-(4-amino-3-methylphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-7-5-9(3-4-10(7)13)12(16)11(15)6-17-8(2)14/h3-5,11-12,15-16H,6,13H2,1-2H3 |
| InChIKey | OUHMIHSFFCERHN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|