C17H19NO4S — CID 170822954
S-[3-[4-(4-aminophenoxy)phenyl]-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822954) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is S-[3-[4-(4-aminophenoxy)phenyl]-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-[4-(4-aminophenoxy)phenyl]-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822954 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | S-[3-[4-(4-aminophenoxy)phenyl]-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-11(19)23-10-16(20)17(21)12-2-6-14(7-3-12)22-15-8-4-13(18)5-9-15/h2-9,16-17,20-21H,10,18H2,1H3 |
| InChIKey | YSYCMKZKLBQOQB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|