C13H18O4S — CID 170821885
S-[3-(4-ethoxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821885) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is S-[3-(4-ethoxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(4-ethoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821885 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | S-[3-(4-ethoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CCOc1ccc(C(O)C(O)CSC(C)=O)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-3-17-11-6-4-10(5-7-11)13(16)12(15)8-18-9(2)14/h4-7,12-13,15-16H,3,8H2,1-2H3 |
| InChIKey | PODPUECFADIXRP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|