C13H17BrO5S — CID 170823177
S-[3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170823177) has the molecular formula C13H17BrO5S and a molecular weight of 365.25 g/mol. Its IUPAC name is S-[3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170823177 |
| Molecular Formula | C13H17BrO5S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | S-[3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CCOc1cc(C(O)C(O)CSC(C)=O)cc(Br)c1O |
| InChI | InChI=1S/C13H17BrO5S/c1-3-19-11-5-8(4-9(14)13(11)18)12(17)10(16)6-20-7(2)15/h4-5,10,12,16-18H,3,6H2,1-2H3 |
| InChIKey | GIENGHCLYJSKGY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|