C15H22O4S — CID 170823192
S-[2,3-dihydroxy-3-[4-(2-methylpropoxy)phenyl]propyl] ethanethioate (PubChem CID 170823192) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-[4-(2-methylpropoxy)phenyl]propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-[4-(2-methylpropoxy)phenyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 170823192 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | S-[2,3-dihydroxy-3-[4-(2-methylpropoxy)phenyl]propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C15H22O4S/c1-10(2)8-19-13-6-4-12(5-7-13)15(18)14(17)9-20-11(3)16/h4-7,10,14-15,17-18H,8-9H2,1-3H3 |
| InChIKey | DEJMRZLZXGQXDX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|