4-(2-methylpropoxy)aniline;oxalic acid

C12H17NO5 — CID 70702357

IUPAC4-(2-methylpropoxy)aniline;oxalic acid
SMILESCC(C)COc1ccc(N)cc1.O=C(O)C(=O)O
InChIInChI=1S/C10H15NO.C2H2O4/c1-8(2)7-12-10-5-3-9(11)4-6-10;3-1(4)2(5)6/h3-6,8H,7,11H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyIZISTVUFALDOGL-UHFFFAOYSA-N
MW255.27 g/mol
LogP1.46
Rot. Bonds3

About 4-(2-methylpropoxy)aniline;oxalic acid

4-(2-methylpropoxy)aniline;oxalic acid (PubChem CID 70702357) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(2-methylpropoxy)aniline;oxalic acid.

Molecular Properties

Compound Name4-(2-methylpropoxy)aniline;oxalic acid
PubChem CID70702357
Molecular FormulaC12H17NO5
Molecular Weight255.27 g/mol
Exact Mass255.11
IUPAC Name4-(2-methylpropoxy)aniline;oxalic acid
SMILESCC(C)COc1ccc(N)cc1.O=C(O)C(=O)O
InChIInChI=1S/C10H15NO.C2H2O4/c1-8(2)7-12-10-5-3-9(11)4-6-10;3-1(4)2(5)6/h3-6,8H,7,11H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyIZISTVUFALDOGL-UHFFFAOYSA-N
XLogP1.46
TPSA109.85 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 51.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-(2-methylpropoxy)aniline;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methylpropoxy)aniline;oxalic acid?
The IUPAC name of 4-(2-methylpropoxy)aniline;oxalic acid (CID 70702357) is 4-(2-methylpropoxy)aniline;oxalic acid.
What is the SMILES notation for 4-(2-methylpropoxy)aniline;oxalic acid?
The canonical SMILES for 4-(2-methylpropoxy)aniline;oxalic acid is CC(C)COc1ccc(N)cc1.O=C(O)C(=O)O.
What is the InChIKey of 4-(2-methylpropoxy)aniline;oxalic acid?
The InChIKey is IZISTVUFALDOGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C2H2O4/c1-8(2)7-12-10-5-3-9(11)4-6-10;3-1(4)2(5)6/h3-6,8H,7,11H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 4-(2-methylpropoxy)aniline;oxalic acid?
4-(2-methylpropoxy)aniline;oxalic acid has a molecular weight of 255.27 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropoxy)aniline;oxalic acid is sourced from PubChem (CID 70702357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).