C11H13IO3S — CID 170823203
S-[2,3-dihydroxy-3-(4-iodophenyl)propyl] ethanethioate (PubChem CID 170823203) has the molecular formula C11H13IO3S and a molecular weight of 352.19 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(4-iodophenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(4-iodophenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170823203 |
| Molecular Formula | C11H13IO3S |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | S-[2,3-dihydroxy-3-(4-iodophenyl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H13IO3S/c1-7(13)16-6-10(14)11(15)8-2-4-9(12)5-3-8/h2-5,10-11,14-15H,6H2,1H3 |
| InChIKey | CGOZZLIKFFZDTC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|