C16H20N2O3 — CID 171882277
4-amino-1-[4-(4-aminophenoxy)phenyl]butane-1,2-diol (PubChem CID 171882277) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-amino-1-[4-(4-aminophenoxy)phenyl]butane-1,2-diol.
| Compound Name | 4-amino-1-[4-(4-aminophenoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171882277 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-amino-1-[4-(4-aminophenoxy)phenyl]butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H20N2O3/c17-10-9-15(19)16(20)11-1-5-13(6-2-11)21-14-7-3-12(18)4-8-14/h1-8,15-16,19-20H,9-10,17-18H2 |
| InChIKey | BGCHBNIYIUNLOR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|