C16H19NO3 — CID 171882229
4-amino-1-(4-phenoxyphenyl)butane-1,2-diol (PubChem CID 171882229) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-amino-1-(4-phenoxyphenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(4-phenoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171882229 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-amino-1-(4-phenoxyphenyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19NO3/c17-11-10-15(18)16(19)12-6-8-14(9-7-12)20-13-4-2-1-3-5-13/h1-9,15-16,18-19H,10-11,17H2 |
| InChIKey | HBOMJVPADRZLON-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |