C12H17NO3 — CID 171881183
1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone (PubChem CID 171881183) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone.
| Compound Name | 1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171881183 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-[4-(4-amino-1,2-dihydroxybutyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(O)C(O)CCN)cc1 |
| InChI | InChI=1S/C12H17NO3/c1-8(14)9-2-4-10(5-3-9)12(16)11(15)6-7-13/h2-5,11-12,15-16H,6-7,13H2,1H3 |
| InChIKey | WLFVWYQZDHXZFN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |