C11H14BrNO3 — CID 171892136
4-(4-bromo-1,2-dihydroxybutyl)benzamide (PubChem CID 171892136) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-(4-bromo-1,2-dihydroxybutyl)benzamide.
| Compound Name | 4-(4-bromo-1,2-dihydroxybutyl)benzamide |
|---|---|
| PubChem CID | 171892136 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-(4-bromo-1,2-dihydroxybutyl)benzamide |
| SMILES | NC(=O)c1ccc(C(O)C(O)CCBr)cc1 |
| InChI | InChI=1S/C11H14BrNO3/c12-6-5-9(14)10(15)7-1-3-8(4-2-7)11(13)16/h1-4,9-10,14-15H,5-6H2,(H2,13,16) |
| InChIKey | JYNAEEIMGGYLLL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|