C9H12BrNO3 — CID 171893071
5-(4-bromo-1,2-dihydroxybutyl)-1H-pyridin-2-one (PubChem CID 171893071) has the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. Its IUPAC name is 5-(4-bromo-1,2-dihydroxybutyl)-1H-pyridin-2-one.
| Compound Name | 5-(4-bromo-1,2-dihydroxybutyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171893071 |
| Molecular Formula | C9H12BrNO3 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 5-(4-bromo-1,2-dihydroxybutyl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(C(O)C(O)CCBr)c[nH]1 |
| InChI | InChI=1S/C9H12BrNO3/c10-4-3-7(12)9(14)6-1-2-8(13)11-5-6/h1-2,5,7,9,12,14H,3-4H2,(H,11,13) |
| InChIKey | IBJAVRREVOSUDS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|