C8H11NO4 — CID 170818894
5-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one (PubChem CID 170818894) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one.
| Compound Name | 5-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170818894 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(C(O)C(O)CO)c[nH]1 |
| InChI | InChI=1S/C8H11NO4/c10-4-6(11)8(13)5-1-2-7(12)9-3-5/h1-3,6,8,10-11,13H,4H2,(H,9,12) |
| InChIKey | ORIYKYZDEGVIOB-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |