C13H13NO6 — CID 170818857
4-oxo-7-(1,2,3-trihydroxypropyl)-1H-quinoline-3-carboxylic acid (PubChem CID 170818857) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-oxo-7-(1,2,3-trihydroxypropyl)-1H-quinoline-3-carboxylic acid.
| Compound Name | 4-oxo-7-(1,2,3-trihydroxypropyl)-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 170818857 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-oxo-7-(1,2,3-trihydroxypropyl)-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2cc(C(O)C(O)CO)ccc2c1=O |
| InChI | InChI=1S/C13H13NO6/c15-5-10(16)11(17)6-1-2-7-9(3-6)14-4-8(12(7)18)13(19)20/h1-4,10-11,15-17H,5H2,(H,14,18)(H,19,20) |
| InChIKey | UVPAIXPUNDMFGK-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |