C8H12N2O2 — CID 55292250
5-[(1R)-1-amino-3-hydroxypropyl]-1H-pyridin-2-one (PubChem CID 55292250) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-[(1R)-1-amino-3-hydroxypropyl]-1H-pyridin-2-one.
| Compound Name | 5-[(1R)-1-amino-3-hydroxypropyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 55292250 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-[(1R)-1-amino-3-hydroxypropyl]-1H-pyridin-2-one |
| SMILES | N[C@H](CCO)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H12N2O2/c9-7(3-4-11)6-1-2-8(12)10-5-6/h1-2,5,7,11H,3-4,9H2,(H,10,12)/t7-/m1/s1 |
| InChIKey | HWDYAZCSOGMAQS-SSDOTTSWSA-N |
| XLogP | -0.24 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |