C8H9N3O3 — CID 173126587
2-(6-oxo-1H-pyridin-3-yl)propanediamide (PubChem CID 173126587) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-(6-oxo-1H-pyridin-3-yl)propanediamide.
| Compound Name | 2-(6-oxo-1H-pyridin-3-yl)propanediamide |
|---|---|
| PubChem CID | 173126587 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(6-oxo-1H-pyridin-3-yl)propanediamide |
| SMILES | NC(=O)C(C(N)=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H9N3O3/c9-7(13)6(8(10)14)4-1-2-5(12)11-3-4/h1-3,6H,(H2,9,13)(H2,10,14)(H,11,12) |
| InChIKey | HELYWTMPUDBZOS-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|