C8H8N2O3 — CID 171871292
2,3-dihydroxy-3-(6-oxo-1H-pyridin-3-yl)propanenitrile (PubChem CID 171871292) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(6-oxo-1H-pyridin-3-yl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(6-oxo-1H-pyridin-3-yl)propanenitrile |
|---|---|
| PubChem CID | 171871292 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2,3-dihydroxy-3-(6-oxo-1H-pyridin-3-yl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H8N2O3/c9-3-6(11)8(13)5-1-2-7(12)10-4-5/h1-2,4,6,8,11,13H,(H,10,12) |
| InChIKey | ZQBDLMUXGOCQLE-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|