C10H10N2O2S — CID 171870245
4-(2-cyano-1,2-dihydroxyethyl)benzenecarbothioamide (PubChem CID 171870245) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-(2-cyano-1,2-dihydroxyethyl)benzenecarbothioamide.
| Compound Name | 4-(2-cyano-1,2-dihydroxyethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 171870245 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-(2-cyano-1,2-dihydroxyethyl)benzenecarbothioamide |
| SMILES | N#CC(O)C(O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C10H10N2O2S/c11-5-8(13)9(14)6-1-3-7(4-2-6)10(12)15/h1-4,8-9,13-14H,(H2,12,15) |
| InChIKey | URAYAJBUPGMDHY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|