C11H12N2O3 — CID 171870719
3-[4-(2-aminoacetyl)phenyl]-2,3-dihydroxypropanenitrile (PubChem CID 171870719) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-[4-(2-aminoacetyl)phenyl]-2,3-dihydroxypropanenitrile.
| Compound Name | 3-[4-(2-aminoacetyl)phenyl]-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870719 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-[4-(2-aminoacetyl)phenyl]-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(C(=O)CN)cc1 |
| InChI | InChI=1S/C11H12N2O3/c12-5-9(14)7-1-3-8(4-2-7)11(16)10(15)6-13/h1-4,10-11,15-16H,5,12H2 |
| InChIKey | FPMBJNFUCFTYBJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|