C11H14N2O2 — CID 171870282
3-[4-(2-aminoethyl)phenyl]-2,3-dihydroxypropanenitrile (PubChem CID 171870282) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)phenyl]-2,3-dihydroxypropanenitrile.
| Compound Name | 3-[4-(2-aminoethyl)phenyl]-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870282 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-[4-(2-aminoethyl)phenyl]-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(CCN)cc1 |
| InChI | InChI=1S/C11H14N2O2/c12-6-5-8-1-3-9(4-2-8)11(15)10(14)7-13/h1-4,10-11,14-15H,5-6,12H2 |
| InChIKey | LQJKCTCBFQTCEB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|