C11H13NO3 — CID 171870155
2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanenitrile (PubChem CID 171870155) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanenitrile.
| Compound Name | 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 171870155 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanenitrile |
| SMILES | COCc1ccc(C(O)C(O)C#N)cc1 |
| InChI | InChI=1S/C11H13NO3/c1-15-7-8-2-4-9(5-3-8)11(14)10(13)6-12/h2-5,10-11,13-14H,7H2,1H3 |
| InChIKey | YRNNZRYQXASOJJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|